C35H34N2O5S — CID 172983106
[(E)-[1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate (PubChem CID 172983106) has the molecular formula C35H34N2O5S and a molecular weight of 594.73 g/mol. Its IUPAC name is [(E)-[1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate.
| Compound Name | [(E)-[1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 172983106 |
| Molecular Formula | C35H34N2O5S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [(E)-[1-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/C(=O)c1ccc(Sc2ccc(C(=O)c3ccc(N4CCOCC4)cc3)cc2)cc1)C1=C(C)C=CCC1C |
| InChI | InChI=1S/C35H34N2O5S/c1-23-5-4-6-24(2)32(23)33(36-42-25(3)38)35(40)28-11-17-31(18-12-28)43-30-15-9-27(10-16-30)34(39)26-7-13-29(14-8-26)37-19-21-41-22-20-37/h4-5,7-18,24H,6,19-22H2,1-3H3/b36-33+ |
| InChIKey | JHZYFBFWRNBZIF-PKUSAGTQSA-N |
| XLogP | 6.92 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|