C23H17N3O7S — CID 134371027
[(E)-[1-(2-methyl-4-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-2-oxoethylidene]amino] acetate (PubChem CID 134371027) has the molecular formula C23H17N3O7S and a molecular weight of 479.47 g/mol. Its IUPAC name is [(E)-[1-(2-methyl-4-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-2-oxoethylidene]amino] acetate.
| Compound Name | [(E)-[1-(2-methyl-4-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 134371027 |
| Molecular Formula | C23H17N3O7S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [(E)-[1-(2-methyl-4-nitrophenyl)-2-[4-(4-nitrophenyl)sulfanylphenyl]-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/C(=O)c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1)c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C23H17N3O7S/c1-14-13-18(26(31)32)7-12-21(14)22(24-33-15(2)27)23(28)16-3-8-19(9-4-16)34-20-10-5-17(6-11-20)25(29)30/h3-13H,1-2H3/b24-22+ |
| InChIKey | NVNZFGRFVDMAFQ-ZNTNEXAZSA-N |
| XLogP | 5.11 |
| TPSA | 142.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|