C34H33FO7S — CID 155242065
2-[4-[4-[(E)-3-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]sulfanyl-3-oxoprop-1-enyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 155242065) has the molecular formula C34H33FO7S and a molecular weight of 604.70 g/mol. Its IUPAC name is 2-[4-[4-[(E)-3-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]sulfanyl-3-oxoprop-1-enyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[(E)-3-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]sulfanyl-3-oxoprop-1-enyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155242065 |
| Molecular Formula | C34H33FO7S |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 2-[4-[4-[(E)-3-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]phenyl]sulfanyl-3-oxoprop-1-enyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(/C=C/C(=O)Sc3ccc(OCCCCOC(=O)C(=C)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H33FO7S/c1-24(2)33(37)42-23-22-40-29-13-11-28(12-14-29)27-9-6-26(7-10-27)8-19-32(36)43-31-17-15-30(16-18-31)39-20-4-5-21-41-34(38)25(3)35/h6-19H,1,3-5,20-23H2,2H3/b19-8+ |
| InChIKey | JRRVRGXWNSOYTK-UFWORHAWSA-N |
| XLogP | 7.37 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|