C7H15NO4S — CID 22719384
2-methylprop-2-enamide;propane-1-sulfonic acid (PubChem CID 22719384) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-methylprop-2-enamide;propane-1-sulfonic acid.
| Compound Name | 2-methylprop-2-enamide;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 22719384 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-methylprop-2-enamide;propane-1-sulfonic acid |
| SMILES | C=C(C)C(N)=O.CCCS(=O)(=O)O |
| InChI | InChI=1S/C4H7NO.C3H8O3S/c1-3(2)4(5)6;1-2-3-7(4,5)6/h1H2,2H3,(H2,5,6);2-3H2,1H3,(H,4,5,6) |
| InChIKey | FVSAFCHCUDOKSI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|