C14H30N2O4Si — CID 159339342
N-[2-[2-aminopropyl(diethoxy)silyl]oxybutan-2-yl]prop-2-enamide (PubChem CID 159339342) has the molecular formula C14H30N2O4Si and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[2-[2-aminopropyl(diethoxy)silyl]oxybutan-2-yl]prop-2-enamide.
| Compound Name | N-[2-[2-aminopropyl(diethoxy)silyl]oxybutan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 159339342 |
| Molecular Formula | C14H30N2O4Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-[2-[2-aminopropyl(diethoxy)silyl]oxybutan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)(CC)O[Si](CC(C)N)(OCC)OCC |
| InChI | InChI=1S/C14H30N2O4Si/c1-7-13(17)16-14(6,8-2)20-21(18-9-3,19-10-4)11-12(5)15/h7,12H,1,8-11,15H2,2-6H3,(H,16,17) |
| InChIKey | LFYDIPSRQOIPPC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|