C14H30N2O4Si — CID 158029719
N-[3-[2-aminopropyl(diethoxy)silyl]oxybutyl]prop-2-enamide (PubChem CID 158029719) has the molecular formula C14H30N2O4Si and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[3-[2-aminopropyl(diethoxy)silyl]oxybutyl]prop-2-enamide.
| Compound Name | N-[3-[2-aminopropyl(diethoxy)silyl]oxybutyl]prop-2-enamide |
|---|---|
| PubChem CID | 158029719 |
| Molecular Formula | C14H30N2O4Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-[3-[2-aminopropyl(diethoxy)silyl]oxybutyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(C)O[Si](CC(C)N)(OCC)OCC |
| InChI | InChI=1S/C14H30N2O4Si/c1-6-14(17)16-10-9-13(5)20-21(18-7-2,19-8-3)11-12(4)15/h6,12-13H,1,7-11,15H2,2-5H3,(H,16,17) |
| InChIKey | FHAOAWUJYUEJGF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|