C6H10NNaO4S — CID 141350323
sodium 2-(prop-2-enoylamino)propan-2-yl sulfite (PubChem CID 141350323) has the molecular formula C6H10NNaO4S and a molecular weight of 215.21 g/mol. Its IUPAC name is sodium 2-(prop-2-enoylamino)propan-2-yl sulfite.
| Compound Name | sodium 2-(prop-2-enoylamino)propan-2-yl sulfite |
|---|---|
| PubChem CID | 141350323 |
| Molecular Formula | C6H10NNaO4S |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | sodium 2-(prop-2-enoylamino)propan-2-yl sulfite |
| SMILES | C=CC(=O)NC(C)(C)OS(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H11NO4S.Na/c1-4-5(8)7-6(2,3)11-12(9)10;/h4H,1H2,2-3H3,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | KDWMHXKZTGUBHW-UHFFFAOYSA-M |
| XLogP | -3.16 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|