C17H24O10 — CID 22377999
[2-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate (PubChem CID 22377999) has the molecular formula C17H24O10 and a molecular weight of 388.37 g/mol. Its IUPAC name is [2-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate.
| Compound Name | [2-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 22377999 |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [2-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COC(C)C(CO)(CO)CO)(OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C17H24O10/c1-5-13(21)25-17(26-14(22)6-2,27-15(23)7-3)11-24-12(4)16(8-18,9-19)10-20/h5-7,12,18-20H,1-3,8-11H2,4H3 |
| InChIKey | HDXIMMKPAAENDS-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|