About [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate
[1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 139630906) has the molecular formula C11H16O8
and a molecular weight of 276.24 g/mol. Its IUPAC name is [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate.
Molecular Properties
| Compound Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate |
| PubChem CID | 139630906 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(O)(OC(=O)C=C)C(CO)(CO)CO |
| InChI | InChI=1S/C11H16O8/c1-3-8(15)18-11(17,19-9(16)4-2)10(5-12,6-13)7-14/h3-4,12-14,17H,1-2,5-7H2 |
| InChIKey | YQLUHMIQNTWIEM-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate?
The IUPAC name of [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate (CID 139630906) is [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate.
What is the SMILES notation for [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate?
The canonical SMILES for [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate is C=CC(=O)OC(O)(OC(=O)C=C)C(CO)(CO)CO.
What is the InChIKey of [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate?
The InChIKey is YQLUHMIQNTWIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O8/c1-3-8(15)18-11(17,19-9(16)4-2)10(5-12,6-13)7-14/h3-4,12-14,17H,1-2,5-7H2.
What are the key properties of [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate?
[1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate has a molecular weight of 276.24 g/mol, XLogP of -1.95, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate is sourced from PubChem (CID 139630906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).