C11H16O8 — CID 139630906
[1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 139630906) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 139630906 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [1,3-dihydroxy-2,2-bis(hydroxymethyl)-1-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(O)(OC(=O)C=C)C(CO)(CO)CO |
| InChI | InChI=1S/C11H16O8/c1-3-8(15)18-11(17,19-9(16)4-2)10(5-12,6-13)7-14/h3-4,12-14,17H,1-2,5-7H2 |
| InChIKey | YQLUHMIQNTWIEM-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|