C13H24O7 — CID 175045459
2-[1-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxyethoxy]ethyl prop-2-enoate (PubChem CID 175045459) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[1-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxyethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxyethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 175045459 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[1-[4-hydroxy-3,3-bis(hydroxymethyl)butan-2-yl]oxyethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(C)OC(C)C(CO)(CO)CO |
| InChI | InChI=1S/C13H24O7/c1-4-12(17)19-6-5-18-11(3)20-10(2)13(7-14,8-15)9-16/h4,10-11,14-16H,1,5-9H2,2-3H3 |
| InChIKey | BUCMVNPICJZTBF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|