C10H18O7 — CID 91411102
2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxyethyl prop-2-enoate (PubChem CID 91411102) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxyethyl prop-2-enoate.
| Compound Name | 2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 91411102 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOOCC(CO)(CO)CO |
| InChI | InChI=1S/C10H18O7/c1-2-9(14)15-3-4-16-17-8-10(5-11,6-12)7-13/h2,11-13H,1,3-8H2 |
| InChIKey | LMOBAQBECCSCMX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|