C16H26O6 — CID 58610616
[2-prop-2-enoyloxy-3-propoxy-2-(propoxymethyl)propyl] prop-2-enoate (PubChem CID 58610616) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is [2-prop-2-enoyloxy-3-propoxy-2-(propoxymethyl)propyl] prop-2-enoate.
| Compound Name | [2-prop-2-enoyloxy-3-propoxy-2-(propoxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 58610616 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [2-prop-2-enoyloxy-3-propoxy-2-(propoxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COCCC)(COCCC)OC(=O)C=C |
| InChI | InChI=1S/C16H26O6/c1-5-9-19-11-16(12-20-10-6-2,22-15(18)8-4)13-21-14(17)7-3/h7-8H,3-6,9-13H2,1-2H3 |
| InChIKey | IPLOTLIWLOSHLK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|