(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate

C16H28O4 — CID 88562783

IUPAC(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate
SMILESC=CC(=O)OC(COC(=O)C(C)(C)CCC)C(C)(C)C
InChIInChI=1S/C16H28O4/c1-8-10-16(6,7)14(18)19-11-12(15(3,4)5)20-13(17)9-2/h9,12H,2,8,10-11H2,1,3-7H3
InChIKeyBOHDKBRZVZVJAI-UHFFFAOYSA-N
MW284.40 g/mol
LogP3.50
Rot. Bonds7

About (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate

(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate (PubChem CID 88562783) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate.

Molecular Properties

Compound Name(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate
PubChem CID88562783
Molecular FormulaC16H28O4
Molecular Weight284.40 g/mol
Exact Mass284.20
IUPAC Name(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate
SMILESC=CC(=O)OC(COC(=O)C(C)(C)CCC)C(C)(C)C
InChIInChI=1S/C16H28O4/c1-8-10-16(6,7)14(18)19-11-12(15(3,4)5)20-13(17)9-2/h9,12H,2,8,10-11H2,1,3-7H3
InChIKeyBOHDKBRZVZVJAI-UHFFFAOYSA-N
XLogP3.50
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 53.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate?
The IUPAC name of (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate (CID 88562783) is (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate.
What is the SMILES notation for (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate?
The canonical SMILES for (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate is C=CC(=O)OC(COC(=O)C(C)(C)CCC)C(C)(C)C.
What is the InChIKey of (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate?
The InChIKey is BOHDKBRZVZVJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-8-10-16(6,7)14(18)19-11-12(15(3,4)5)20-13(17)9-2/h9,12H,2,8,10-11H2,1,3-7H3.
What are the key properties of (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate?
(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate has a molecular weight of 284.40 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate is sourced from PubChem (CID 88562783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).