C16H28O4 — CID 88562783
(3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate (PubChem CID 88562783) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate.
| Compound Name | (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 88562783 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (3,3-dimethyl-2-prop-2-enoyloxybutyl) 2,2-dimethylpentanoate |
| SMILES | C=CC(=O)OC(COC(=O)C(C)(C)CCC)C(C)(C)C |
| InChI | InChI=1S/C16H28O4/c1-8-10-16(6,7)14(18)19-11-12(15(3,4)5)20-13(17)9-2/h9,12H,2,8,10-11H2,1,3-7H3 |
| InChIKey | BOHDKBRZVZVJAI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|