C34H50MgO12 — CID 141469581
magnesium bis(4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)-2-propylpentanoate) (PubChem CID 141469581) has the molecular formula C34H50MgO12 and a molecular weight of 675.07 g/mol. Its IUPAC name is magnesium bis(4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)-2-propylpentanoate).
| Compound Name | magnesium bis(4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)-2-propylpentanoate) |
|---|---|
| PubChem CID | 141469581 |
| Molecular Formula | C34H50MgO12 |
| Molecular Weight | 675.07 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | magnesium bis(4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)-2-propylpentanoate) |
| SMILES | C=CC(=O)OC(C)CC(CCC)(CC(C)OC(=O)C=C)C(=O)[O-].C=CC(=O)OC(C)CC(CCC)(CC(C)OC(=O)C=C)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C17H26O6.Mg/c2*1-6-9-17(16(20)21,10-12(4)22-14(18)7-2)11-13(5)23-15(19)8-3;/h2*7-8,12-13H,2-3,6,9-11H2,1,4-5H3,(H,20,21);/q;;+2/p-2 |
| InChIKey | VCVWVGLQMAIIDZ-UHFFFAOYSA-L |
| XLogP | 2.70 |
| TPSA | 185.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|