About 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+)
2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) (PubChem CID 141469617) has the molecular formula C16H23O6Rb
and a molecular weight of 396.82 g/mol. Its IUPAC name is 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+).
Molecular Properties
| Compound Name | 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) |
| PubChem CID | 141469617 |
| Molecular Formula | C16H23O6Rb |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) |
| SMILES | C=CC(=O)OC(C)CC(CC)(CC(C)OC(=O)C=C)C(=O)[O-].[Rb+] |
| InChI | InChI=1S/C16H24O6.Rb/c1-6-13(17)21-11(4)9-16(8-3,15(19)20)10-12(5)22-14(18)7-2;/h6-7,11-12H,1-2,8-10H2,3-5H3,(H,19,20);/q;+1/p-1 |
| InChIKey | ALEABOZHIQKHRK-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+)?
The IUPAC name of 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) (CID 141469617) is 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+).
What is the SMILES notation for 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+)?
The canonical SMILES for 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) is C=CC(=O)OC(C)CC(CC)(CC(C)OC(=O)C=C)C(=O)[O-].[Rb+].
What is the InChIKey of 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+)?
The InChIKey is ALEABOZHIQKHRK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H24O6.Rb/c1-6-13(17)21-11(4)9-16(8-3,15(19)20)10-12(5)22-14(18)7-2;/h6-7,11-12H,1-2,8-10H2,3-5H3,(H,19,20);/q;+1/p-1.
What are the key properties of 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+)?
2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) has a molecular weight of 396.82 g/mol, XLogP of -1.85, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-prop-2-enoyloxy-2-(2-prop-2-enoyloxypropyl)pentanoate;rubidium(1+) is sourced from PubChem (CID 141469617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).