C17H32O8 — CID 131978337
bis[1-(1-methoxypropan-2-yloxy)propan-2-yl] propanedioate (PubChem CID 131978337) has the molecular formula C17H32O8 and a molecular weight of 364.44 g/mol. Its IUPAC name is bis[1-(1-methoxypropan-2-yloxy)propan-2-yl] propanedioate.
| Compound Name | bis[1-(1-methoxypropan-2-yloxy)propan-2-yl] propanedioate |
|---|---|
| PubChem CID | 131978337 |
| Molecular Formula | C17H32O8 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | bis[1-(1-methoxypropan-2-yloxy)propan-2-yl] propanedioate |
| SMILES | COCC(C)OCC(C)OC(=O)CC(=O)OC(C)COC(C)COC |
| InChI | InChI=1S/C17H32O8/c1-12(8-20-5)22-10-14(3)24-16(18)7-17(19)25-15(4)11-23-13(2)9-21-6/h12-15H,7-11H2,1-6H3 |
| InChIKey | RKYGWCUQGNQOFM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|