C18H30O10 — CID 58177628
2-O,3-O-bis(1-methoxypropan-2-yl) 1-O,4-O-dimethyl butane-1,2,3,4-tetracarboxylate (PubChem CID 58177628) has the molecular formula C18H30O10 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-O,3-O-bis(1-methoxypropan-2-yl) 1-O,4-O-dimethyl butane-1,2,3,4-tetracarboxylate.
| Compound Name | 2-O,3-O-bis(1-methoxypropan-2-yl) 1-O,4-O-dimethyl butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 58177628 |
| Molecular Formula | C18H30O10 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-O,3-O-bis(1-methoxypropan-2-yl) 1-O,4-O-dimethyl butane-1,2,3,4-tetracarboxylate |
| SMILES | COCC(C)OC(=O)C(CC(=O)OC)C(CC(=O)OC)C(=O)OC(C)COC |
| InChI | InChI=1S/C18H30O10/c1-11(9-23-3)27-17(21)13(7-15(19)25-5)14(8-16(20)26-6)18(22)28-12(2)10-24-4/h11-14H,7-10H2,1-6H3 |
| InChIKey | MGDNVGNIEXACEB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|