About 1-methoxypropan-2-yl 2-ethoxypropanoate
1-methoxypropan-2-yl 2-ethoxypropanoate (PubChem CID 88537715) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2-ethoxypropanoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 2-ethoxypropanoate |
| PubChem CID | 88537715 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-methoxypropan-2-yl 2-ethoxypropanoate |
| SMILES | CCOC(C)C(=O)OC(C)COC |
| InChI | InChI=1S/C9H18O4/c1-5-12-8(3)9(10)13-7(2)6-11-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | GPFCSDYEFUKVAE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropan-2-yl 2-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 2-ethoxypropanoate?
The IUPAC name of 1-methoxypropan-2-yl 2-ethoxypropanoate (CID 88537715) is 1-methoxypropan-2-yl 2-ethoxypropanoate.
What is the SMILES notation for 1-methoxypropan-2-yl 2-ethoxypropanoate?
The canonical SMILES for 1-methoxypropan-2-yl 2-ethoxypropanoate is CCOC(C)C(=O)OC(C)COC.
What is the InChIKey of 1-methoxypropan-2-yl 2-ethoxypropanoate?
The InChIKey is GPFCSDYEFUKVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-5-12-8(3)9(10)13-7(2)6-11-4/h7-8H,5-6H2,1-4H3.
What are the key properties of 1-methoxypropan-2-yl 2-ethoxypropanoate?
1-methoxypropan-2-yl 2-ethoxypropanoate has a molecular weight of 190.24 g/mol, XLogP of 0.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 2-ethoxypropanoate is sourced from PubChem (CID 88537715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).