About 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate
1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate (PubChem CID 107825394) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate |
| PubChem CID | 107825394 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate |
| SMILES | COCC(C)OC(=O)[C@@H](N)CCO |
| InChI | InChI=1S/C8H17NO4/c1-6(5-12-2)13-8(11)7(9)3-4-10/h6-7,10H,3-5,9H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | HJNYUVKRGCSSRC-MLWJPKLSSA-N |
| XLogP | -0.73 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate?
The IUPAC name of 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate (CID 107825394) is 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate.
What is the SMILES notation for 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate?
The canonical SMILES for 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate is COCC(C)OC(=O)[C@@H](N)CCO.
What is the InChIKey of 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate?
The InChIKey is HJNYUVKRGCSSRC-MLWJPKLSSA-N. The full InChI is InChI=1S/C8H17NO4/c1-6(5-12-2)13-8(11)7(9)3-4-10/h6-7,10H,3-5,9H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate?
1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate has a molecular weight of 191.23 g/mol, XLogP of -0.73, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl (2S)-2-amino-4-hydroxybutanoate is sourced from PubChem (CID 107825394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).