About 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate
1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate (PubChem CID 107837627) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate |
| PubChem CID | 107837627 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate |
| SMILES | COCC(C)OC(=O)[C@@H](O)CN |
| InChI | InChI=1S/C7H15NO4/c1-5(4-11-2)12-7(10)6(9)3-8/h5-6,9H,3-4,8H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | AMTNWRSHZPMFKA-GDVGLLTNSA-N |
| XLogP | -1.12 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate?
The IUPAC name of 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate (CID 107837627) is 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate.
What is the SMILES notation for 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate?
The canonical SMILES for 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate is COCC(C)OC(=O)[C@@H](O)CN.
What is the InChIKey of 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate?
The InChIKey is AMTNWRSHZPMFKA-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H15NO4/c1-5(4-11-2)12-7(10)6(9)3-8/h5-6,9H,3-4,8H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate?
1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate has a molecular weight of 177.20 g/mol, XLogP of -1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl (2S)-3-amino-2-hydroxypropanoate is sourced from PubChem (CID 107837627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).