butan-2-yl 4-amino-2-hydroxybutanoate

C8H17NO3 — CID 107837492

IUPACbutan-2-yl 4-amino-2-hydroxybutanoate
SMILESCCC(C)OC(=O)C(O)CCN
InChIInChI=1S/C8H17NO3/c1-3-6(2)12-8(11)7(10)4-5-9/h6-7,10H,3-5,9H2,1-2H3
InChIKeyUMXMQZCRGSYIGQ-UHFFFAOYSA-N
MW175.23 g/mol
LogP0.04
Rot. Bonds5

About butan-2-yl 4-amino-2-hydroxybutanoate

butan-2-yl 4-amino-2-hydroxybutanoate (PubChem CID 107837492) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is butan-2-yl 4-amino-2-hydroxybutanoate.

Molecular Properties

Compound Namebutan-2-yl 4-amino-2-hydroxybutanoate
PubChem CID107837492
Molecular FormulaC8H17NO3
Molecular Weight175.23 g/mol
Exact Mass175.12
IUPAC Namebutan-2-yl 4-amino-2-hydroxybutanoate
SMILESCCC(C)OC(=O)C(O)CCN
InChIInChI=1S/C8H17NO3/c1-3-6(2)12-8(11)7(10)4-5-9/h6-7,10H,3-5,9H2,1-2H3
InChIKeyUMXMQZCRGSYIGQ-UHFFFAOYSA-N
XLogP0.04
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.23
LogP ≤ 50.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze butan-2-yl 4-amino-2-hydroxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl 4-amino-2-hydroxybutanoate?
The IUPAC name of butan-2-yl 4-amino-2-hydroxybutanoate (CID 107837492) is butan-2-yl 4-amino-2-hydroxybutanoate.
What is the SMILES notation for butan-2-yl 4-amino-2-hydroxybutanoate?
The canonical SMILES for butan-2-yl 4-amino-2-hydroxybutanoate is CCC(C)OC(=O)C(O)CCN.
What is the InChIKey of butan-2-yl 4-amino-2-hydroxybutanoate?
The InChIKey is UMXMQZCRGSYIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-3-6(2)12-8(11)7(10)4-5-9/h6-7,10H,3-5,9H2,1-2H3.
What are the key properties of butan-2-yl 4-amino-2-hydroxybutanoate?
butan-2-yl 4-amino-2-hydroxybutanoate has a molecular weight of 175.23 g/mol, XLogP of 0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 4-amino-2-hydroxybutanoate is sourced from PubChem (CID 107837492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).