C10H21NO3 — CID 103927421
1-methoxypropan-2-yl (2R)-2-amino-3,3-dimethylbutanoate (PubChem CID 103927421) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-methoxypropan-2-yl (2R)-2-amino-3,3-dimethylbutanoate.
| Compound Name | 1-methoxypropan-2-yl (2R)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 103927421 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-methoxypropan-2-yl (2R)-2-amino-3,3-dimethylbutanoate |
| SMILES | COCC(C)OC(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-7(6-13-5)14-9(12)8(11)10(2,3)4/h7-8H,6,11H2,1-5H3/t7?,8-/m0/s1 |
| InChIKey | QMFJRJJHNBUBJP-MQWKRIRWSA-N |
| XLogP | 0.94 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |