About 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate
1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate (PubChem CID 81161403) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate |
| PubChem CID | 81161403 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate |
| SMILES | COCC(C)OC(=O)CC1(CN)CCC1 |
| InChI | InChI=1S/C11H21NO3/c1-9(7-14-2)15-10(13)6-11(8-12)4-3-5-11/h9H,3-8,12H2,1-2H3 |
| InChIKey | RGARMQADZGOKDD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate?
The IUPAC name of 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate (CID 81161403) is 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate.
What is the SMILES notation for 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate?
The canonical SMILES for 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate is COCC(C)OC(=O)CC1(CN)CCC1.
What is the InChIKey of 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate?
The InChIKey is RGARMQADZGOKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-9(7-14-2)15-10(13)6-11(8-12)4-3-5-11/h9H,3-8,12H2,1-2H3.
What are the key properties of 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate?
1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate has a molecular weight of 215.29 g/mol, XLogP of 1.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 2-[1-(aminomethyl)cyclobutyl]acetate is sourced from PubChem (CID 81161403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).