About methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate
methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate (PubChem CID 66098922) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate.
Analyze methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate?
The IUPAC name of methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate (CID 66098922) is methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate.
What is the SMILES notation for methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate?
The canonical SMILES for methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate is COC(=O)CC1(CN)CCCC(C)(C)CC1.
What is the InChIKey of methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate?
The InChIKey is IENBLACYJYVUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-12(2)5-4-6-13(10-14,8-7-12)9-11(15)16-3/h4-10,14H2,1-3H3.
What are the key properties of methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate?
methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate has a molecular weight of 227.35 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(aminomethyl)-4,4-dimethylcycloheptyl]acetate is sourced from PubChem (CID 66098922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).