About 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate
1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate (PubChem CID 115451059) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate |
| PubChem CID | 115451059 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate |
| SMILES | COCC(C)OC(=O)C1(CN)CC1 |
| InChI | InChI=1S/C9H17NO3/c1-7(5-12-2)13-8(11)9(6-10)3-4-9/h7H,3-6,10H2,1-2H3 |
| InChIKey | RSVGHMCZLSKHTL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate?
The IUPAC name of 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate (CID 115451059) is 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate?
The canonical SMILES for 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate is COCC(C)OC(=O)C1(CN)CC1.
What is the InChIKey of 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate?
The InChIKey is RSVGHMCZLSKHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-7(5-12-2)13-8(11)9(6-10)3-4-9/h7H,3-6,10H2,1-2H3.
What are the key properties of 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate?
1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate has a molecular weight of 187.24 g/mol, XLogP of 0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 1-(aminomethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 115451059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).