About 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate
3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate (PubChem CID 115440262) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate |
| PubChem CID | 115440262 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate |
| SMILES | CC(C)C(C)OC(=O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C12H23NO3/c1-9(2)10(3)16-11(14)12(8-13)4-6-15-7-5-12/h9-10H,4-8,13H2,1-3H3 |
| InChIKey | VTJFIWKKTXWCGV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate?
The IUPAC name of 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate (CID 115440262) is 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate.
What is the SMILES notation for 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate?
The canonical SMILES for 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate is CC(C)C(C)OC(=O)C1(CN)CCOCC1.
What is the InChIKey of 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate?
The InChIKey is VTJFIWKKTXWCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-9(2)10(3)16-11(14)12(8-13)4-6-15-7-5-12/h9-10H,4-8,13H2,1-3H3.
What are the key properties of 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate?
3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate has a molecular weight of 229.32 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 4-(aminomethyl)oxane-4-carboxylate is sourced from PubChem (CID 115440262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).