C11H20N2O4 — CID 115439497
methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]propanoate (PubChem CID 115439497) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]propanoate.
| Compound Name | methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 115439497 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C11H20N2O4/c1-8(9(14)16-2)13-10(15)11(7-12)3-5-17-6-4-11/h8H,3-7,12H2,1-2H3,(H,13,15) |
| InChIKey | DTNPYHYSTLORJZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |