C12H23ClN2O4 — CID 120922194
methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]butanoate;hydrochloride (PubChem CID 120922194) has the molecular formula C12H23ClN2O4 and a molecular weight of 294.78 g/mol. Its IUPAC name is methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]butanoate;hydrochloride.
| Compound Name | methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 120922194 |
| Molecular Formula | C12H23ClN2O4 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]butanoate;hydrochloride |
| SMILES | CCC(NC(=O)C1(CN)CCOCC1)C(=O)OC.Cl |
| InChI | InChI=1S/C12H22N2O4.ClH/c1-3-9(10(15)17-2)14-11(16)12(8-13)4-6-18-7-5-12;/h9H,3-8,13H2,1-2H3,(H,14,16);1H |
| InChIKey | FMDNQTZJFLTVGA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |