C10H18N2O5 — CID 113310101
2-[[4-(aminomethyl)oxane-4-carbonyl]amino]-3-hydroxypropanoic acid (PubChem CID 113310101) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 113310101 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCC1(C(=O)NC(CO)C(=O)O)CCOCC1 |
| InChI | InChI=1S/C10H18N2O5/c11-6-10(1-3-17-4-2-10)9(16)12-7(5-13)8(14)15/h7,13H,1-6,11H2,(H,12,16)(H,14,15) |
| InChIKey | DSBQUESNVUNXGN-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |