C22H38O9 — CID 87327032
3-[3-[3-(3-hydroxyheptanoyloxy)hexanoyloxy]pentanoyloxy]butanoic acid (PubChem CID 87327032) has the molecular formula C22H38O9 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-[3-[3-(3-hydroxyheptanoyloxy)hexanoyloxy]pentanoyloxy]butanoic acid.
| Compound Name | 3-[3-[3-(3-hydroxyheptanoyloxy)hexanoyloxy]pentanoyloxy]butanoic acid |
|---|---|
| PubChem CID | 87327032 |
| Molecular Formula | C22H38O9 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 3-[3-[3-(3-hydroxyheptanoyloxy)hexanoyloxy]pentanoyloxy]butanoic acid |
| SMILES | CCCCC(O)CC(=O)OC(CCC)CC(=O)OC(CC)CC(=O)OC(C)CC(=O)O |
| InChI | InChI=1S/C22H38O9/c1-5-8-10-16(23)12-20(26)31-18(9-6-2)14-22(28)30-17(7-3)13-21(27)29-15(4)11-19(24)25/h15-18,23H,5-14H2,1-4H3,(H,24,25) |
| InChIKey | PMGGCPNLRCBMGX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|