C27H44O21 — CID 153455041
1,3-bis[2-(2-hydroxybutoxycarbonyloxy)ethoxycarbonyloxy]propan-2-yl 2-(2-hydroxybutoxycarbonyloxy)ethyl carbonate (PubChem CID 153455041) has the molecular formula C27H44O21 and a molecular weight of 704.63 g/mol. Its IUPAC name is 1,3-bis[2-(2-hydroxybutoxycarbonyloxy)ethoxycarbonyloxy]propan-2-yl 2-(2-hydroxybutoxycarbonyloxy)ethyl carbonate.
| Compound Name | 1,3-bis[2-(2-hydroxybutoxycarbonyloxy)ethoxycarbonyloxy]propan-2-yl 2-(2-hydroxybutoxycarbonyloxy)ethyl carbonate |
|---|---|
| PubChem CID | 153455041 |
| Molecular Formula | C27H44O21 |
| Molecular Weight | 704.63 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | 1,3-bis[2-(2-hydroxybutoxycarbonyloxy)ethoxycarbonyloxy]propan-2-yl 2-(2-hydroxybutoxycarbonyloxy)ethyl carbonate |
| SMILES | CCC(O)COC(=O)OCCOC(=O)OCC(COC(=O)OCCOC(=O)OCC(O)CC)OC(=O)OCCOC(=O)OCC(O)CC |
| InChI | InChI=1S/C27H44O21/c1-4-18(28)13-43-22(31)37-7-9-40-25(34)46-16-21(48-27(36)42-12-11-39-24(33)45-15-20(30)6-3)17-47-26(35)41-10-8-38-23(32)44-14-19(29)5-2/h18-21,28-30H,4-17H2,1-3H3 |
| InChIKey | VUTZRVNYLKQIBS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 273.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|