C13H20N2O5 — CID 130466355
1-(2-prop-2-enoyloxyethylcarbamoylamino)propan-2-yl 2-methylprop-2-enoate (PubChem CID 130466355) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-(2-prop-2-enoyloxyethylcarbamoylamino)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-(2-prop-2-enoyloxyethylcarbamoylamino)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130466355 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2-prop-2-enoyloxyethylcarbamoylamino)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)NCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H20N2O5/c1-5-11(16)19-7-6-14-13(18)15-8-10(4)20-12(17)9(2)3/h5,10H,1-2,6-8H2,3-4H3,(H2,14,15,18) |
| InChIKey | OAUJFLHANQCWAE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|