C14H18N2O3 — CID 17357847
3-ethoxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide (PubChem CID 17357847) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-ethoxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide.
| Compound Name | 3-ethoxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 17357847 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-ethoxy-N'-[(E)-3-phenylprop-2-enoyl]propanehydrazide |
| SMILES | CCOCCC(=O)NNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3/c1-2-19-11-10-14(18)16-15-13(17)9-8-12-6-4-3-5-7-12/h3-9H,2,10-11H2,1H3,(H,15,17)(H,16,18)/b9-8+ |
| InChIKey | DECXXIGCBNZZSB-CMDGGOBGSA-N |
| XLogP | 1.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|