C19H20N2O3 — CID 17343908
(E)-N'-[2-(2,3-dimethylphenoxy)acetyl]-3-phenylprop-2-enehydrazide (PubChem CID 17343908) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (E)-N'-[2-(2,3-dimethylphenoxy)acetyl]-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,3-dimethylphenoxy)acetyl]-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 17343908 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (E)-N'-[2-(2,3-dimethylphenoxy)acetyl]-3-phenylprop-2-enehydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)/C=C/c2ccccc2)c1C |
| InChI | InChI=1S/C19H20N2O3/c1-14-7-6-10-17(15(14)2)24-13-19(23)21-20-18(22)12-11-16-8-4-3-5-9-16/h3-12H,13H2,1-2H3,(H,20,22)(H,21,23)/b12-11+ |
| InChIKey | PEBMHNHNVOFKSS-VAWYXSNFSA-N |
| XLogP | 2.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|