C21H17ClN2O3 — CID 17195601
(E)-3-(4-chlorophenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide (PubChem CID 17195601) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide.
| Compound Name | (E)-3-(4-chlorophenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 17195601 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NNC(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C21H17ClN2O3/c22-17-11-8-15(9-12-17)10-13-20(25)23-24-21(26)14-27-19-7-3-5-16-4-1-2-6-18(16)19/h1-13H,14H2,(H,23,25)(H,24,26)/b13-10+ |
| InChIKey | JJZFZEZWGMEREB-JLHYYAGUSA-N |
| XLogP | 3.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|