C21H18N2O5 — CID 162670976
(E)-3-(3,4-dihydroxyphenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide (PubChem CID 162670976) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 162670976 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N'-(2-naphthalen-1-yloxyacetyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NNC(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C21H18N2O5/c24-17-10-8-14(12-18(17)25)9-11-20(26)22-23-21(27)13-28-19-7-3-5-15-4-1-2-6-16(15)19/h1-12,24-25H,13H2,(H,22,26)(H,23,27)/b11-9+ |
| InChIKey | XINVEFXYCNWTDI-PKNBQFBNSA-N |
| XLogP | 2.49 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|