C12H20NO2P — CID 145020306
[(2E,6E)-6-methylnona-2,6,8-trienyl] N-methylphosphanylcarbamate (PubChem CID 145020306) has the molecular formula C12H20NO2P and a molecular weight of 241.27 g/mol. Its IUPAC name is [(2E,6E)-6-methylnona-2,6,8-trienyl] N-methylphosphanylcarbamate.
| Compound Name | [(2E,6E)-6-methylnona-2,6,8-trienyl] N-methylphosphanylcarbamate |
|---|---|
| PubChem CID | 145020306 |
| Molecular Formula | C12H20NO2P |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | [(2E,6E)-6-methylnona-2,6,8-trienyl] N-methylphosphanylcarbamate |
| SMILES | C=C/C=C(\C)CC/C=C/COC(=O)NPC |
| InChI | InChI=1S/C12H20NO2P/c1-4-8-11(2)9-6-5-7-10-15-12(14)13-16-3/h4-5,7-8,16H,1,6,9-10H2,2-3H3,(H,13,14)/b7-5+,11-8+ |
| InChIKey | AENSDNWXARCODF-PAQHSLSSSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|