About N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine
N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine (PubChem CID 104929644) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine |
| PubChem CID | 104929644 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine |
| SMILES | C=C(C)CCC(C)=CCCNC(C)(C)C |
| InChI | InChI=1S/C14H27N/c1-12(2)9-10-13(3)8-7-11-15-14(4,5)6/h8,15H,1,7,9-11H2,2-6H3 |
| InChIKey | MFUYIZLCOSNCSS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine?
The IUPAC name of N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine (CID 104929644) is N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine.
What is the SMILES notation for N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine?
The canonical SMILES for N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine is C=C(C)CCC(C)=CCCNC(C)(C)C.
What is the InChIKey of N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine?
The InChIKey is MFUYIZLCOSNCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N/c1-12(2)9-10-13(3)8-7-11-15-14(4,5)6/h8,15H,1,7,9-11H2,2-6H3.
What are the key properties of N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine?
N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine has a molecular weight of 209.38 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,7-dimethylocta-3,7-dien-1-amine is sourced from PubChem (CID 104929644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).