C10H18F3N — CID 79607121
N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine (PubChem CID 79607121) has the molecular formula C10H18F3N and a molecular weight of 209.25 g/mol. Its IUPAC name is N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine.
| Compound Name | N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79607121 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine |
| SMILES | CC(=CCCNC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N/c1-8(10(11,12)13)6-5-7-14-9(2,3)4/h6,14H,5,7H2,1-4H3 |
| InChIKey | MXXFEMJSXMOFND-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|