About N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine
N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine (PubChem CID 79607121) has the molecular formula C10H18F3N
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine |
| PubChem CID | 79607121 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine |
| SMILES | CC(=CCCNC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N/c1-8(10(11,12)13)6-5-7-14-9(2,3)4/h6,14H,5,7H2,1-4H3 |
| InChIKey | MXXFEMJSXMOFND-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine?
The IUPAC name of N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine (CID 79607121) is N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine.
What is the SMILES notation for N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine?
The canonical SMILES for N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine is CC(=CCCNC(C)(C)C)C(F)(F)F.
What is the InChIKey of N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine?
The InChIKey is MXXFEMJSXMOFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N/c1-8(10(11,12)13)6-5-7-14-9(2,3)4/h6,14H,5,7H2,1-4H3.
What are the key properties of N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine?
N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine has a molecular weight of 209.25 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5,5,5-trifluoro-4-methylpent-3-en-1-amine is sourced from PubChem (CID 79607121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).