C8H13Cl — CID 123504902
2-chloro-5-methylhepta-1,5-diene (PubChem CID 123504902) has the molecular formula C8H13Cl and a molecular weight of 144.64 g/mol. Its IUPAC name is 2-chloro-5-methylhepta-1,5-diene.
| Compound Name | 2-chloro-5-methylhepta-1,5-diene |
|---|---|
| PubChem CID | 123504902 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.64 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-chloro-5-methylhepta-1,5-diene |
| SMILES | C=C(Cl)CCC(C)=CC |
| InChI | InChI=1S/C8H13Cl/c1-4-7(2)5-6-8(3)9/h4H,3,5-6H2,1-2H3 |
| InChIKey | HKCQBTZTUQOWIY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|