C13H19N — CID 57407840
1-(2,3-dimethylphenyl)pentan-1-imine (PubChem CID 57407840) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)pentan-1-imine.
| Compound Name | 1-(2,3-dimethylphenyl)pentan-1-imine |
|---|---|
| PubChem CID | 57407840 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(2,3-dimethylphenyl)pentan-1-imine |
| SMILES | [H]/N=C(\CCCC)c1cccc(C)c1C |
| InChI | InChI=1S/C13H19N/c1-4-5-9-13(14)12-8-6-7-10(2)11(12)3/h6-8,14H,4-5,9H2,1-3H3/b14-13+ |
| InChIKey | DVHYZPFTDHSTOP-BUHFOSPRSA-N |
| XLogP | 3.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|