C14H19F2NO2 — CID 156722218
2,2-difluoro-1-(2-methylphenyl)ethanimine;pentanoic acid (PubChem CID 156722218) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2,2-difluoro-1-(2-methylphenyl)ethanimine;pentanoic acid.
| Compound Name | 2,2-difluoro-1-(2-methylphenyl)ethanimine;pentanoic acid |
|---|---|
| PubChem CID | 156722218 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2,2-difluoro-1-(2-methylphenyl)ethanimine;pentanoic acid |
| SMILES | CCCCC(=O)O.[H]/N=C(/c1ccccc1C)C(F)F |
| InChI | InChI=1S/C9H9F2N.C5H10O2/c1-6-4-2-3-5-7(6)8(12)9(10)11;1-2-3-4-5(6)7/h2-5,9,12H,1H3;2-4H2,1H3,(H,6,7)/b12-8-; |
| InChIKey | XYHQZTBJTFOFMG-JCTPKUEWSA-N |
| XLogP | 3.89 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|