About butane;1-(2,3-dimethylphenyl)ethanimine
butane;1-(2,3-dimethylphenyl)ethanimine (PubChem CID 177029537) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is butane;1-(2,3-dimethylphenyl)ethanimine.
Molecular Properties
| Compound Name | butane;1-(2,3-dimethylphenyl)ethanimine |
| PubChem CID | 177029537 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | butane;1-(2,3-dimethylphenyl)ethanimine |
| SMILES | CCCC.[H]/N=C(\C)c1cccc(C)c1C |
| InChI | InChI=1S/C10H13N.C4H10/c1-7-5-4-6-10(8(7)2)9(3)11;1-3-4-2/h4-6,11H,1-3H3;3-4H2,1-2H3/b11-9+; |
| InChIKey | VOLKJKMKCURFGR-LBEJWNQZSA-N |
| XLogP | 4.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;1-(2,3-dimethylphenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-(2,3-dimethylphenyl)ethanimine?
The IUPAC name of butane;1-(2,3-dimethylphenyl)ethanimine (CID 177029537) is butane;1-(2,3-dimethylphenyl)ethanimine.
What is the SMILES notation for butane;1-(2,3-dimethylphenyl)ethanimine?
The canonical SMILES for butane;1-(2,3-dimethylphenyl)ethanimine is CCCC.[H]/N=C(\C)c1cccc(C)c1C.
What is the InChIKey of butane;1-(2,3-dimethylphenyl)ethanimine?
The InChIKey is VOLKJKMKCURFGR-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H13N.C4H10/c1-7-5-4-6-10(8(7)2)9(3)11;1-3-4-2/h4-6,11H,1-3H3;3-4H2,1-2H3/b11-9+;.
What are the key properties of butane;1-(2,3-dimethylphenyl)ethanimine?
butane;1-(2,3-dimethylphenyl)ethanimine has a molecular weight of 205.34 g/mol, XLogP of 4.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-(2,3-dimethylphenyl)ethanimine is sourced from PubChem (CID 177029537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).