C14H21N — CID 142080417
1-(2,3-dimethylphenyl)-2-methylprop-2-en-1-imine;ethane (PubChem CID 142080417) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2-methylprop-2-en-1-imine;ethane.
| Compound Name | 1-(2,3-dimethylphenyl)-2-methylprop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 142080417 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2-methylprop-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C(\C(=C)C)c1cccc(C)c1C |
| InChI | InChI=1S/C12H15N.C2H6/c1-8(2)12(13)11-7-5-6-9(3)10(11)4;1-2/h5-7,13H,1H2,2-4H3;1-2H3/b13-12+; |
| InChIKey | UXTOEIHCRCLJBJ-UEIGIMKUSA-N |
| XLogP | 4.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|