C23H36 — CID 155690336
1-(2,5-dimethyl-4-methylidenehexa-2,5-dien-3-yl)-2,3-dimethylbenzene;ethane;2-methylprop-1-ene (PubChem CID 155690336) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1-(2,5-dimethyl-4-methylidenehexa-2,5-dien-3-yl)-2,3-dimethylbenzene;ethane;2-methylprop-1-ene.
| Compound Name | 1-(2,5-dimethyl-4-methylidenehexa-2,5-dien-3-yl)-2,3-dimethylbenzene;ethane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 155690336 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1-(2,5-dimethyl-4-methylidenehexa-2,5-dien-3-yl)-2,3-dimethylbenzene;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)C(=C)C(=C(C)C)c1cccc(C)c1C.CC |
| InChI | InChI=1S/C17H22.C4H8.C2H6/c1-11(2)14(6)17(12(3)4)16-10-8-9-13(5)15(16)7;1-4(2)3;1-2/h8-10H,1,6H2,2-5,7H3;1H2,2-3H3;1-2H3 |
| InChIKey | JKILOVYNLPQAPC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|