C13H16S — CID 143503279
(3E)-3-(2,3-dimethylphenyl)penta-1,3-diene-2-thiol (PubChem CID 143503279) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is (3E)-3-(2,3-dimethylphenyl)penta-1,3-diene-2-thiol.
| Compound Name | (3E)-3-(2,3-dimethylphenyl)penta-1,3-diene-2-thiol |
|---|---|
| PubChem CID | 143503279 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (3E)-3-(2,3-dimethylphenyl)penta-1,3-diene-2-thiol |
| SMILES | C=C(S)/C(=C/C)c1cccc(C)c1C |
| InChI | InChI=1S/C13H16S/c1-5-12(11(4)14)13-8-6-7-9(2)10(13)3/h5-8,14H,4H2,1-3H3/b12-5- |
| InChIKey | UGGGQKHYHJEUAO-XGICHPGQSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|