About O-ethenyl 2,3-dimethylbenzenecarbothioate
O-ethenyl 2,3-dimethylbenzenecarbothioate (PubChem CID 54517016) has the molecular formula C11H12OS
and a molecular weight of 192.28 g/mol. Its IUPAC name is O-ethenyl 2,3-dimethylbenzenecarbothioate.
Molecular Properties
| Compound Name | O-ethenyl 2,3-dimethylbenzenecarbothioate |
| PubChem CID | 54517016 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | O-ethenyl 2,3-dimethylbenzenecarbothioate |
| SMILES | C=COC(=S)c1cccc(C)c1C |
| InChI | InChI=1S/C11H12OS/c1-4-12-11(13)10-7-5-6-8(2)9(10)3/h4-7H,1H2,2-3H3 |
| InChIKey | YNCLKIFBGDTONR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethenyl 2,3-dimethylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethenyl 2,3-dimethylbenzenecarbothioate?
The IUPAC name of O-ethenyl 2,3-dimethylbenzenecarbothioate (CID 54517016) is O-ethenyl 2,3-dimethylbenzenecarbothioate.
What is the SMILES notation for O-ethenyl 2,3-dimethylbenzenecarbothioate?
The canonical SMILES for O-ethenyl 2,3-dimethylbenzenecarbothioate is C=COC(=S)c1cccc(C)c1C.
What is the InChIKey of O-ethenyl 2,3-dimethylbenzenecarbothioate?
The InChIKey is YNCLKIFBGDTONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12OS/c1-4-12-11(13)10-7-5-6-8(2)9(10)3/h4-7H,1H2,2-3H3.
What are the key properties of O-ethenyl 2,3-dimethylbenzenecarbothioate?
O-ethenyl 2,3-dimethylbenzenecarbothioate has a molecular weight of 192.28 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethenyl 2,3-dimethylbenzenecarbothioate is sourced from PubChem (CID 54517016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).