C19H22O2Si — CID 18960351
(2,3-dimethylphenyl)-[(4-ethenylphenoxy)-dimethylsilyl]methanone (PubChem CID 18960351) has the molecular formula C19H22O2Si and a molecular weight of 310.47 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-[(4-ethenylphenoxy)-dimethylsilyl]methanone.
| Compound Name | (2,3-dimethylphenyl)-[(4-ethenylphenoxy)-dimethylsilyl]methanone |
|---|---|
| PubChem CID | 18960351 |
| Molecular Formula | C19H22O2Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2,3-dimethylphenyl)-[(4-ethenylphenoxy)-dimethylsilyl]methanone |
| SMILES | C=Cc1ccc(O[Si](C)(C)C(=O)c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C19H22O2Si/c1-6-16-10-12-17(13-11-16)21-22(4,5)19(20)18-9-7-8-14(2)15(18)3/h6-13H,1H2,2-5H3 |
| InChIKey | NVOVZXITLFRFEK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|