C13H17N — CID 143797983
N-[1-(2,3-dimethylphenyl)ethenyl]prop-1-en-2-amine (PubChem CID 143797983) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-[1-(2,3-dimethylphenyl)ethenyl]prop-1-en-2-amine.
| Compound Name | N-[1-(2,3-dimethylphenyl)ethenyl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143797983 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-[1-(2,3-dimethylphenyl)ethenyl]prop-1-en-2-amine |
| SMILES | C=C(C)NC(=C)c1cccc(C)c1C |
| InChI | InChI=1S/C13H17N/c1-9(2)14-12(5)13-8-6-7-10(3)11(13)4/h6-8,14H,1,5H2,2-4H3 |
| InChIKey | GXUMKUKIULPNTP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |