C20H23N — CID 142080482
N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline (PubChem CID 142080482) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline.
| Compound Name | N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 142080482 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline |
| SMILES | C=C(Nc1ccccc1C)/C(=C/C)c1cccc(C)c1C |
| InChI | InChI=1S/C20H23N/c1-6-18(19-12-9-11-14(2)16(19)4)17(5)21-20-13-8-7-10-15(20)3/h6-13,21H,5H2,1-4H3/b18-6- |
| InChIKey | YXLIUFPIQDRMES-FXBPXSCXSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|