About N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline
N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline (PubChem CID 142080482) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline.
Molecular Properties
| Compound Name | N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline |
| PubChem CID | 142080482 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline |
| SMILES | C=C(Nc1ccccc1C)/C(=C/C)c1cccc(C)c1C |
| InChI | InChI=1S/C20H23N/c1-6-18(19-12-9-11-14(2)16(19)4)17(5)21-20-13-8-7-10-15(20)3/h6-13,21H,5H2,1-4H3/b18-6- |
| InChIKey | YXLIUFPIQDRMES-FXBPXSCXSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline?
The IUPAC name of N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline (CID 142080482) is N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline.
What is the SMILES notation for N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline?
The canonical SMILES for N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline is C=C(Nc1ccccc1C)/C(=C/C)c1cccc(C)c1C.
What is the InChIKey of N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline?
The InChIKey is YXLIUFPIQDRMES-FXBPXSCXSA-N. The full InChI is InChI=1S/C20H23N/c1-6-18(19-12-9-11-14(2)16(19)4)17(5)21-20-13-8-7-10-15(20)3/h6-13,21H,5H2,1-4H3/b18-6-.
What are the key properties of N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline?
N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline has a molecular weight of 277.41 g/mol, XLogP of 5.64, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-3-(2,3-dimethylphenyl)penta-1,3-dien-2-yl]-2-methylaniline is sourced from PubChem (CID 142080482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).